CAS 82408-83-1 appears in our catalog under these names: 9H-Carbazole-2-carboxylic acid, ethyl ester, 95%, ethyl 9H–carbazole–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 9H-carbazole-2-carboxylate (CAS 82408-83-1) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: ethyl 9H-carbazole-2-carboxylate. InChIKey: HKQJHFRKEOPUGT-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | ethyl 9H-carbazole-2-carboxylate |
| InChIKey | HKQJHFRKEOPUGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)