CAS 82486-81-5 appears in our catalog under these names: 2-Amino-4,6-dichlorobenzaldehyde, 97%, 2-Amino-4,6-dichlorobenzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-4,6-dichlorobenzaldehyde (CAS 82486-81-5) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-amino-4,6-dichlorobenzaldehyde. InChIKey: FHWPDPWZNATBKF-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2-amino-4,6-dichlorobenzaldehyde |
| InChIKey | FHWPDPWZNATBKF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)C=O)Cl)Cl |
Computed by PubChem (NCBI)