CAS 825643-82-1 is the registry number for 2-(3,5-Dichlorophenyl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,5-dichlorophenyl)-2-methylpropanoic acid (CAS 825643-82-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-methylpropanoic acid. InChIKey: ROCPJVPEURDFOW-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-methylpropanoic acid |
| InChIKey | ROCPJVPEURDFOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)