CAS 82702-31-6 appears in our catalog under these names: Methyl 3–bromo–4–fluorobenzoate, Methyl 3-Bromo-4-fluorobenzoate, >98.0%(GC), 3-Bromo-4-fluoro-benzoic acid methyl ester, 95%, Methyl 3-bromo-4-fluorobenzoate, 97%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
Methyl 3-bromo-4-fluorobenzoate (CAS 82702-31-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: methyl 3-bromo-4-fluorobenzoate. InChIKey: JVORYGNKYAXATM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | methyl 3-bromo-4-fluorobenzoate |
| InChIKey | JVORYGNKYAXATM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)