Products 827605-41-4
CAS 827605-41-4 is the registry number for 2-Butyl-6-ethynyl-1H-benzo(de)isoquinoline-1,3(2H)-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
2-butyl-6-ethynylbenzo[de]isoquinoline-1,3-dione (CAS 827605-41-4) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 2-butyl-6-ethynylbenzo[de]isoquinoline-1,3-dione. InChIKey: UDZCIEWUCQBGDJ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 2-butyl-6-ethynylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | UDZCIEWUCQBGDJ-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)C#C)C=CC=C3C1=O |
Computed by PubChem (NCBI)