Products 827612-81-7
CAS 827612-81-7 is the registry number for 1-(Phenylcarbamoyl)piperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(phenylcarbamoyl)piperidine-3-carboxylic acid (CAS 827612-81-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 1-(phenylcarbamoyl)piperidine-3-carboxylic acid. InChIKey: UKCJZGIJDOLOQJ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-(phenylcarbamoyl)piperidine-3-carboxylic acid |
| InChIKey | UKCJZGIJDOLOQJ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)