CAS 83070-12-6 is the registry number for Isavuconazole Impurity 114. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-bromoacetyl)benzamide (CAS 83070-12-6) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 4-(2-bromoacetyl)benzamide. InChIKey: CJNTYWZJTJBEQW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 4-(2-bromoacetyl)benzamide |
| InChIKey | CJNTYWZJTJBEQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)C(=O)N |
Computed by PubChem (NCBI)