CAS 83104-76-1 is the registry number for N-(3,4-dihydroxystyryl)acetamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]acetamide (CAS 83104-76-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: N-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]acetamide. InChIKey: LTVSVRGGYNFOEB-SNAWJCMRSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | N-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]acetamide |
| InChIKey | LTVSVRGGYNFOEB-SNAWJCMRSA-N |
| SMILES | CC(=O)N/C=C/C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)