Products 831242-96-7
CAS 831242-96-7 is the registry number for 3-(1,1-Dimethylethyl)-5-methyl-2-(phenylmethoxy)benzaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-tert-butyl-5-methyl-2-phenylmethoxybenzaldehyde (CAS 831242-96-7) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: 3-tert-butyl-5-methyl-2-phenylmethoxybenzaldehyde. InChIKey: SHWFVINFGHFMSK-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 3-tert-butyl-5-methyl-2-phenylmethoxybenzaldehyde |
| InChIKey | SHWFVINFGHFMSK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)OCC2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)