Products 83249-04-1
CAS 83249-04-1 appears in our catalog under these names: 3–Phenylbicyclo(1·1·1)pentane–1–carboxylic acid, 3-Phenylbicyclo[1.1.1]pentane-1-carboxylic acid, 95%, 3-Phenylbicyclo[1.1.1]pentane-1-carboxylic acid 97%, 3-PHENYLBICYCLO[1.1.1]PENTANE-1-CARBOXYLIC ACID, 97%, 3-Phenylbicyclo[1.1.1]pentane-1-carboxylic Acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g, 10g.
3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 83249-04-1) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: MVSLMXUOSHYKID-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | MVSLMXUOSHYKID-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)