CAS 83265-56-9 appears in our catalog under these names: 2-Amino-5-(trifluoromethoxy)benzoic acid, 98% , 2-Amino-5-(trifluoromethoxy)benzoic acid, 2-amino-5-(trifluoromethoxy)benzoic acid, 97%, 97%, 2-Amino-5-trifluoromethoxy-benzoic acid, 95%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g.
2-amino-5-(trifluoromethoxy)benzoic acid (CAS 83265-56-9) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 2-amino-5-(trifluoromethoxy)benzoic acid. InChIKey: UXNGDCBPIGOZFO-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethoxy)benzoic acid |
| InChIKey | UXNGDCBPIGOZFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)N |
Computed by PubChem (NCBI)