CAS 83324-59-8 appears in our catalog under these names: 3-Chloro-4,6-dihydroxy-2-methylbenzaldehyde, 95%, 3-Chloro-4,6-dihydroxy-2-methylbenzaldehyde. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
3-chloro-4,6-dihydroxy-2-methylbenzaldehyde (CAS 83324-59-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-4,6-dihydroxy-2-methylbenzaldehyde. InChIKey: PNYFAHZOTZFWGP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-4,6-dihydroxy-2-methylbenzaldehyde |
| InChIKey | PNYFAHZOTZFWGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)O)O)C=O |
Computed by PubChem (NCBI)