CAS 83407-41-4 is the registry number for 6-Methylamino-7-methyl-5-nitroquinoline. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
N,7-dimethyl-5-nitroquinolin-6-amine (CAS 83407-41-4) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: N,7-dimethyl-5-nitroquinolin-6-amine. InChIKey: NMAKNHMEWSMOBG-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | N,7-dimethyl-5-nitroquinolin-6-amine |
| InChIKey | NMAKNHMEWSMOBG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC=N2)C(=C1NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)