CAS 838-11-9 is the registry number for 2,6-Dihydroxyxanthone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dihydroxyxanthen-9-one (CAS 838-11-9) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 2,6-dihydroxyxanthen-9-one. InChIKey: UHFHFHSHVGUMIQ-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2,6-dihydroxyxanthen-9-one |
| InChIKey | UHFHFHSHVGUMIQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)