CAS 838-95-9 is the registry number for 4-(Dimethylamino)stilbene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.
N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline (CAS 838-95-9) is a chemical compound with the molecular formula C16H17N and a molecular weight of 223.31 g/mol. IUPAC name: N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline. InChIKey: XGHHHPDRXLIMPM-CMDGGOBGSA-N.
| Molecular formula | C16H17N |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline |
| InChIKey | XGHHHPDRXLIMPM-CMDGGOBGSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)