CAS 83846-66-6 appears in our catalog under these names: 1-(4-Methylphenyl)-1-cyclopropanecarboxylic Acid, >95% (HPLC), 1-(4-Methylphenyl)-1-cyclopropanecarboxylic acid, 98%, 1-(4-METHYLPHENYL)-1-CYCLOPROPANECARBOXYLIC ACID, 98%, 98%, 1-(4-Methylphenyl)cyclopropanecarboxylic acid, 98%, 1-(p-Tolyl)cyclopropanecarboxylic acid, 98%. Offered by: TRC, Thermo Scientific (Acros), Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 500mg, 50mg, 10g, 250mg, 1g, 5g, 25g.
1-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 83846-66-6) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: AYUGAOYMYXSOKU-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(4-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | AYUGAOYMYXSOKU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)