CAS 838875-37-9 is the registry number for 1-(2-Chlorophenyl)-N-methylmethanesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
1-(2-chlorophenyl)-N-methylmethanesulfonamide (CAS 838875-37-9) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 1-(2-chlorophenyl)-N-methylmethanesulfonamide. InChIKey: MTDTXGKGAKGHCJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-N-methylmethanesulfonamide |
| InChIKey | MTDTXGKGAKGHCJ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)