CAS 84-51-5 appears in our catalog under these names: 2-Ethyl-anthraquinone, >95% (HPLC), 2-Ethylanthraquinone, 2–Ethylanthraquinone, 2-Ethylanthraquinone, 98% , 2-Ethyl anthraquinone. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 100mg, 500g, 2kg, 1kg, 25g, 100g.
2-ethylanthracene-9,10-dione (CAS 84-51-5) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2-ethylanthracene-9,10-dione. InChIKey: SJEBAWHUJDUKQK-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2-ethylanthracene-9,10-dione |
| InChIKey | SJEBAWHUJDUKQK-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)