CAS 84007-57-8 is the registry number for Methyl 5-chloro-2,3-dihydro-1H-indene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-2,3-dihydro-1H-indene-2-carboxylate (CAS 84007-57-8) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: methyl 5-chloro-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: YZERAOLJKCDEHY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | methyl 5-chloro-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | YZERAOLJKCDEHY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)