Products 840529-98-8
CAS 840529-98-8 appears in our catalog under these names: 4-Anilino-4-oxobutanoic Acid-d5, >95% (HPLC), 4–Anilino–4–oxobutanoic Acid–d5, 4-Anilino-4-oxobutanoic acid-d5, 99.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
4-oxo-4-(2,3,4,5,6-pentadeuterioanilino)butanoic acid (CAS 840529-98-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 198.23 g/mol. IUPAC name: 4-oxo-4-(2,3,4,5,6-pentadeuterioanilino)butanoic acid. InChIKey: KTFGFGGLCMGYTP-RALIUCGRSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 198.23 g/mol |
| IUPAC name | 4-oxo-4-(2,3,4,5,6-pentadeuterioanilino)butanoic acid |
| InChIKey | KTFGFGGLCMGYTP-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)CCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)