Products 84228-43-3
CAS 84228-43-3 appears in our catalog under these names: Ethyl 3-amino-4-nitrobenzoate, 95%, ethyl 3-amino-4-nitrobenzoate, 98%, Ethyl 3-amino-4-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg, 2.5g, 100mg.
Ethyl 3-amino-4-nitrobenzoate (CAS 84228-43-3) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: ethyl 3-amino-4-nitrobenzoate. InChIKey: ANNPFRZKDGTZHX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | ethyl 3-amino-4-nitrobenzoate |
| InChIKey | ANNPFRZKDGTZHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)