CAS 84228-45-5 appears in our catalog under these names: Methyl 4–amino–2–nitrobenzoate, Methyl 4-amino-2-nitrobenzoate 98%, Methyl 4-amino-2-nitrobenzoate, 98%, 98%, METHYL 4-AMINO-2-NITROBENZOATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g, 100g.
Methyl 4-amino-2-nitrobenzoate (CAS 84228-45-5) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 4-amino-2-nitrobenzoate. InChIKey: CWNMNVHDDCDSPU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 4-amino-2-nitrobenzoate |
| InChIKey | CWNMNVHDDCDSPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)