CAS 84228-46-6 appears in our catalog under these names: 4–Amino–2–Nitro–Benzoic Acid Ethyl Ester, Ethyl 4-amino-2-nitrobenzoate, Ethyl 4-amino-2-nitrobenzoate 95%, Ethyl 4-amino-2-nitrobenzoate, 97%, 97%, Ethyl 4-amino-2-nitrobenzoate, 95%+(LC-MS),RG. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 250mg.
Ethyl 4-amino-2-nitrobenzoate (CAS 84228-46-6) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: ethyl 4-amino-2-nitrobenzoate. InChIKey: YOMQIQZTFBDFSR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | ethyl 4-amino-2-nitrobenzoate |
| InChIKey | YOMQIQZTFBDFSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)