CAS 84344-22-9 appears in our catalog under these names: L–Phenylalanine,Indole–15N, L-Phenylalanine,Indole-15N, 99.6%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 100 mg, 50 mg, 25 mg, 10 mg.
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid (CAS 84344-22-9) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 205.22 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-DQOKOWHWSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 205.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-DQOKOWHWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C[15NH]2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)