Products 843615-63-4
CAS 843615-63-4 is the registry number for Methyl 3-[(chloroacetyl)amino]-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-[(2-chloroacetyl)amino]-1H-indole-2-carboxylate (CAS 843615-63-4) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: methyl 3-[(2-chloroacetyl)amino]-1H-indole-2-carboxylate. InChIKey: DSQNBOXIFTWCPF-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | methyl 3-[(2-chloroacetyl)amino]-1H-indole-2-carboxylate |
| InChIKey | DSQNBOXIFTWCPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2N1)NC(=O)CCl |
Computed by PubChem (NCBI)