CAS 84418-43-9 appears in our catalog under these names: 9H-Fluorene-9-methanol, 9-carbamate, 98%, 98%, 9-Fluorenylmethyl carbamate, 99%, 9-Fluorenylmethyl carbamate, 99.94%, 9-Fluorenylmethyl Carbamate, >98.0%(HPLC)(N), Fmoc-nh2. Offered by: Chemat, Thermo Scientific (Acros), MedChemExpress, TCI, TRC. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 500 g.
9H-fluoren-9-ylmethyl carbamate (CAS 84418-43-9) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl carbamate. InChIKey: ZZOKVYOCRSMTSS-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl carbamate |
| InChIKey | ZZOKVYOCRSMTSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N |
Computed by PubChem (NCBI)