Products 845616-12-8
CAS 845616-12-8 appears in our catalog under these names: 2–Bromo–5–cyanobenzoic acid, 2-Bromo-5-cyanobenzoic acid, 2-Bromo-5-cyanobenzoic acid 95%, 2-Bromo-5-cyanobenzoic acid, 95%, 95%, 2-Bromo-5-cyanobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 10g, 5g.
2-bromo-5-cyanobenzoic acid (CAS 845616-12-8) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromo-5-cyanobenzoic acid. InChIKey: LFMSICZVBGWOIA-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromo-5-cyanobenzoic acid |
| InChIKey | LFMSICZVBGWOIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)Br |
Computed by PubChem (NCBI)