Products 845823-15-6
CAS 845823-15-6 appears in our catalog under these names: 1-(4-Chloro-3-fluorophenyl)-2,2,2-trifluoroethanone, ≥98.8%, ≥98.8%, 4'-Chloro-2,2,2,3'-tetrafluoroacetophenone, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone (CAS 845823-15-6) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: RTSKOTZMSATBTN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | RTSKOTZMSATBTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)F)Cl |
Computed by PubChem (NCBI)