Products 84759-05-7
CAS 84759-05-7 appears in our catalog under these names: Trimethoprim EP Impurity J-d9 (3,4,5-Trimethoxybenzoic Acid-d9), 3,4,5-Trimethoxy-d9-benzoic Acid, 99 atom % D, min 98% Chemical Purity, 3,4,5-Trimethoxybenzoic acid-d3. Offered by: Chemat Brand, CDN, MedChemExpress. Available pack sizes: on request, 0,5g, 0,25g, 1 mg.
3,4,5-tris(trideuteriomethoxy)benzoic acid (CAS 84759-05-7) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 221.25 g/mol. IUPAC name: 3,4,5-tris(trideuteriomethoxy)benzoic acid. InChIKey: SJSOFNCYXJUNBT-GQALSZNTSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 3,4,5-tris(trideuteriomethoxy)benzoic acid |
| InChIKey | SJSOFNCYXJUNBT-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])C(=O)O |
Computed by PubChem (NCBI)