CAS 847802-91-9 appears in our catalog under these names: 6-Hydroxy-n-methyl-1-naphthamide, 95%, 6-Hydroxy-N-methyl-1-naphthamide 95%, 6-Hydroxy-N-Methyl-1-Naphthamide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
6-hydroxy-N-methylnaphthalene-1-carboxamide (CAS 847802-91-9) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 6-hydroxy-N-methylnaphthalene-1-carboxamide. InChIKey: NCTCADPFOMVLRZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-hydroxy-N-methylnaphthalene-1-carboxamide |
| InChIKey | NCTCADPFOMVLRZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)