CAS 848357-82-4 appears in our catalog under these names: 1-{5-bromo-1H-thieno(3,2-c)pyrazol-1-yl}ethan-1-one, 95%, 1-{5-Bromo-1H-thieno(3,2-c)pyrazol-1-yl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
1-(5-bromothieno[2,3-d]pyrazol-1-yl)ethanone (CAS 848357-82-4) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 1-(5-bromothieno[2,3-d]pyrazol-1-yl)ethanone. InChIKey: ONRCUSFGTGNYIE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(5-bromothieno[2,3-d]pyrazol-1-yl)ethanone |
| InChIKey | ONRCUSFGTGNYIE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=N1)SC(=C2)Br |
Computed by PubChem (NCBI)