CAS 84954-30-3 is the registry number for 4-Benzyloxy-biphenyl. Offered by: TRC. Available pack sizes: 1g.
1-phenyl-4-phenylmethoxybenzene (CAS 84954-30-3) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 1-phenyl-4-phenylmethoxybenzene. InChIKey: URCLAPRSZLWPGP-UHFFFAOYSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-phenyl-4-phenylmethoxybenzene |
| InChIKey | URCLAPRSZLWPGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)