CAS 85003-78-7 appears in our catalog under these names: 2-(5-Amino-1,3,4-thiadiazol-2-yl)phenol, 2-(5-Amino-1,3,4-thiadiazol-2-yl)phenol, 97%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 5g.
2-(5-amino-1,3,4-thiadiazol-2-yl)phenol (CAS 85003-78-7) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 2-(5-amino-1,3,4-thiadiazol-2-yl)phenol. InChIKey: HZGMYJKHGDYTGS-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 2-(5-amino-1,3,4-thiadiazol-2-yl)phenol |
| InChIKey | HZGMYJKHGDYTGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)N)O |
Computed by PubChem (NCBI)