CAS 85052-87-5 is the registry number for 2-((4-Chlorophenyl)sulfonyl)ethanamine, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-(4-chlorophenyl)sulfonylethanamine (CAS 85052-87-5) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfonylethanamine. InChIKey: DFTUTJWZDJHCGI-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)sulfonylethanamine |
| InChIKey | DFTUTJWZDJHCGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCN)Cl |
Computed by PubChem (NCBI)