Products 850544-16-0
CAS 850544-16-0 is the registry number for 6-(2-(Dimethylamino)vinyl)-3-nitropyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(E)-2-(dimethylamino)ethenyl]-3-nitropyridin-2-amine (CAS 850544-16-0) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 6-[(E)-2-(dimethylamino)ethenyl]-3-nitropyridin-2-amine. InChIKey: PMLPGMJIXUVUIF-AATRIKPKSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 6-[(E)-2-(dimethylamino)ethenyl]-3-nitropyridin-2-amine |
| InChIKey | PMLPGMJIXUVUIF-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C1=NC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)