CAS 85068-35-5 appears in our catalog under these names: 2,4-Difluorobenzophenone, 98%, (2,4-Difluorophenyl)(phenyl)methanone, 95%, 2,4-Difluorobenzophenone, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
(2,4-difluorophenyl)-phenylmethanone (CAS 85068-35-5) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,4-difluorophenyl)-phenylmethanone. InChIKey: FRHMSTHFVFIPCO-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,4-difluorophenyl)-phenylmethanone |
| InChIKey | FRHMSTHFVFIPCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)