CAS 85112-35-2 appears in our catalog under these names: 4-(4-Ethylphenyl)-1,3-thiazol-2-amine, 4-(4-Ethyl-phenyl)-thiazol-2-ylamine, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2000mg, 1000mg, 5g, 1g.
4-(4-ethylphenyl)-1,3-thiazol-2-amine (CAS 85112-35-2) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(4-ethylphenyl)-1,3-thiazol-2-amine. InChIKey: YDFOGNLELPWXHU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(4-ethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | YDFOGNLELPWXHU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)