CAS 85123-28-0 appears in our catalog under these names: 5-Chloro-6-nitrobenzo(d)thiazole, 97%, 5-Chloro-6-nitro-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-6-nitro-1,3-benzothiazole (CAS 85123-28-0) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 5-chloro-6-nitro-1,3-benzothiazole. InChIKey: OCARCLRLOLFHPY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 5-chloro-6-nitro-1,3-benzothiazole |
| InChIKey | OCARCLRLOLFHPY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)[N+](=O)[O-])SC=N2 |
Computed by PubChem (NCBI)