CAS 852123-08-1 appears in our catalog under these names: 4–(Benzyloxy)–6–bromo–1,3–benzodioxole, 4-(Benzyloxy)-6-bromo-1,3-benzodioxole, 4-(Benzyloxy)-6-bromo-1,3-benzodioxole 95%, 4-(Benzyloxy)-6-bromo-1,3-benzodioxole, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 1000mg, 5000mg, 100mg.
6-bromo-4-phenylmethoxy-1,3-benzodioxole (CAS 852123-08-1) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 6-bromo-4-phenylmethoxy-1,3-benzodioxole. InChIKey: WRTBUBAFIOQKGH-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 6-bromo-4-phenylmethoxy-1,3-benzodioxole |
| InChIKey | WRTBUBAFIOQKGH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)Br)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)