Products 852816-12-7
CAS 852816-12-7 is the registry number for Ethyl 5-(4-methoxyphenyl)-1-methyl-1H-pyrazole-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
Ethyl 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate (CAS 852816-12-7) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: ethyl 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate. InChIKey: XCVRBXLNJNCVMJ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | ethyl 5-(4-methoxyphenyl)-1-methylpyrazole-3-carboxylate |
| InChIKey | XCVRBXLNJNCVMJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)