Products 852956-34-4
CAS 852956-34-4 is the registry number for 2-Chloro-N-[furan-2-yl(phenyl)methyl]acetamide, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-N-[furan-2-yl(phenyl)methyl]acetamide (CAS 852956-34-4) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: 2-chloro-N-[furan-2-yl(phenyl)methyl]acetamide. InChIKey: CZXQFYYXMSVEED-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 2-chloro-N-[furan-2-yl(phenyl)methyl]acetamide |
| InChIKey | CZXQFYYXMSVEED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CO2)NC(=O)CCl |
Computed by PubChem (NCBI)