CAS 853403-98-2 is the registry number for (1R,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid. Offered by: TRC. Available pack sizes: 500mg.
Trans-(1R,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid (CAS 853403-98-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: trans-(1R,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid. InChIKey: RSKLUEWLQHXYTN-DTWKUNHWSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RSKLUEWLQHXYTN-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)