Products 876606-65-4
CAS 876606-65-4 is the registry number for (1S,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid. Offered by: TRC. Available pack sizes: 250mg.
Cis-(1S,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid (CAS 876606-65-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: cis-(1S,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid. InChIKey: RSKLUEWLQHXYTN-IUCAKERBSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | cis-(1S,2R)-2-(4-aminophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RSKLUEWLQHXYTN-IUCAKERBSA-N |
| SMILES | C1[C@H]([C@H]1C(=O)O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)