CAS 99060-12-5 is the registry number for 2-(4-Aminophenyl)cyclopropane-1-carboxylic acid. Offered by: TRC. Available pack sizes: 500mg.
2-(4-aminophenyl)cyclopropane-1-carboxylic acid (CAS 99060-12-5) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 2-(4-aminophenyl)cyclopropane-1-carboxylic acid. InChIKey: RSKLUEWLQHXYTN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-(4-aminophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RSKLUEWLQHXYTN-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)