CAS 853723-85-0 is the registry number for 6-Chloro-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine (CAS 853723-85-0) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 6-chloro-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: LNFCBUZYKZEFBB-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 6-chloro-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | LNFCBUZYKZEFBB-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C(=CC(=C2)CCl)Cl)OC1 |
Computed by PubChem (NCBI)