Products 853998-94-4

CAS 853998-94-4 is the registry number for Limaprost Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

7-[2-(3-hydroxy-5-methylnon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid (CAS 853998-94-4) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: 7-[2-(3-hydroxy-5-methylnon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid. InChIKey: CNNBNXXMENIOCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H34O4
Molecular weight362.5 g/mol
IUPAC name7-[2-(3-hydroxy-5-methylnon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-2-enoic acid
InChIKeyCNNBNXXMENIOCQ-UHFFFAOYSA-N
SMILESCCCCC(C)CC(C=CC1C=CC(=O)C1CCCCC=CC(=O)O)O

Computed by PubChem (NCBI)