Products 31716-11-7
CAS 31716-11-7 appears in our catalog under these names: Mutilin 11-Acetate, Tiamulin EP Impurity K (Mutilin 11-Acetate). Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
[(1S,2R,3S,4S,6R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] acetate (CAS 31716-11-7) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: [(1S,2R,3S,4S,6R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] acetate. InChIKey: OZOJWAKLTZBJIF-UWHCKELVSA-N.
| Molecular formula | C22H34O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | [(1S,2R,3S,4S,6R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] acetate |
| InChIKey | OZOJWAKLTZBJIF-UWHCKELVSA-N |
| SMILES | C[C@@H]1CC[C@@]23CCC(=O)[C@H]2C1([C@@H](C[C@@]([C@H]([C@@H]3C)OC(=O)C)(C)C=C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Tiamulin EP Impurity K