Products 61827-62-1

CAS 61827-62-1 is the registry number for Hexyl Octyl Phthalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

1-O-hexyl 2-O-octyl benzene-1,2-dicarboxylate (CAS 61827-62-1) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: 1-O-hexyl 2-O-octyl benzene-1,2-dicarboxylate. InChIKey: LZCTXAGBGKLUBX-UHFFFAOYSA-N.

Identity
Molecular formulaC22H34O4
Molecular weight362.5 g/mol
IUPAC name1-O-hexyl 2-O-octyl benzene-1,2-dicarboxylate
InChIKeyLZCTXAGBGKLUBX-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC

Computed by PubChem (NCBI)