Products 28393-02-4
CAS 28393-02-4 appears in our catalog under these names: 10,12-Docosadiynedioic acid, 95%, 10,12–Docosadiynedioic acid, 10,12-Docosadiynedioic acid, 95% , 10,12-Docosadiynedioic acid 95%, Docosa-10,12-diynedioic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Docosa-10,12-diynedioic acid (CAS 28393-02-4) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: docosa-10,12-diynedioic acid. InChIKey: XCUAGNLOPZWTEH-UHFFFAOYSA-N.
| Molecular formula | C22H34O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | docosa-10,12-diynedioic acid |
| InChIKey | XCUAGNLOPZWTEH-UHFFFAOYSA-N |
| SMILES | C(CCCCC(=O)O)CCCC#CC#CCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)