Products 41451-28-9

CAS 41451-28-9 is the registry number for Phthalic acid, bis-isoheptyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Bis(5-methylhexyl) benzene-1,2-dicarboxylate (CAS 41451-28-9) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: bis(5-methylhexyl) benzene-1,2-dicarboxylate. InChIKey: RKELNIPLHQEBJO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H34O4
Molecular weight362.5 g/mol
IUPAC namebis(5-methylhexyl) benzene-1,2-dicarboxylate
InChIKeyRKELNIPLHQEBJO-UHFFFAOYSA-N
SMILESCC(C)CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCC(C)C

Computed by PubChem (NCBI)